ChemNet > CAS > 374538-04-2 4-Cyclohexylbenzeneboronic acid
374538-04-2 4-Cyclohexylbenzeneboronic acid
| 상품명칭 |
4-Cyclohexylbenzeneboronic acid |
| 별명 |
4-Cyclohexylphenylboronic acid |
| 분자식 |
C12H17BO2 |
| 분자량 |
204.0732 |
| InChI |
InChI=1/C12H17BO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10,14-15H,1-5H2 |
| cas번호 |
374538-04-2 |
| 분자 구조 |
|
| 밀도 |
1.09g/cm3 |
| 비등점 |
363.7°C at 760 mmHg |
| 굴절 지수 |
1.543 |
| 인화점 |
173.8°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
